missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dimethyl Phthalate, 99%
CAS: 131-11-3 | C10H10O4 | 194.19 g/mol
$51.95 - $111.12
Chemical Identifiers
| CAS | 131-11-3 |
|---|---|
| Molecular Formula | C10H10O4 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00008425 |
| InChI Key | NIQCNGHVCWTJSM-UHFFFAOYSA-N |
| Synonym | dimethyl phthalate, dimethylphthalate, solvanom, solvarone, avolin, fermine, phthalic acid dimethyl ester, mipax, palatinol m, unimoll dm |
| PubChem CID | 8554 |
| ChEBI | CHEBI:4609 |
| IUPAC Name | dimethyl benzene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=CC=CC=C1C(=O)OC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC116642500
|
Thermo Scientific Chemicals
116642500 |
250 mL | Glass bottle |
Each for $51.95
|
|
||||
|
AC116640010
|
Thermo Scientific Chemicals
116640010 |
1 L | Glass bottle |
Each for $111.12
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 131-11-3 | |
| 194.19 | |
| NIQCNGHVCWTJSM-UHFFFAOYSA-N | |
| 8554 | |
| dimethyl benzene-1,2-dicarboxylate |
| C10H10O4 | |
| MFCD00008425 | |
| dimethyl phthalate, dimethylphthalate, solvanom, solvarone, avolin, fermine, phthalic acid dimethyl ester, mipax, palatinol m, unimoll dm | |
| CHEBI:4609 | |
| COC(=O)C1=CC=CC=C1C(=O)OC |
Specifications
| 131-11-3 | |
| 282°C | |
| Authentic | |
| Glass bottle | |
| 1.5140 to 1.516 | |
| 250 mL | |
| 1.19 | |
| dimethyl phthalate, dimethylphthalate, solvanom, solvarone, avolin, fermine, phthalic acid dimethyl ester, mipax, palatinol m, unimoll dm | |
| NIQCNGHVCWTJSM-UHFFFAOYSA-N | |
| dimethyl benzene-1,2-dicarboxylate | |
| 8554 | |
| CHEBI:4609 | |
| 99% | |
| Dimethyl phthalate |
| 1.1900g/mL | |
| 150°C | |
| 98.5% min. (GC) | |
| C10H10O4 | |
| MFCD00008425 | |
| 09, 797 | |
| 15, 3279 | |
| Solubility in water: negligible. Other solubilities: miscible with organic solvents,insoluble in paraffinic hydrocarbons,slightly soluble in mineral oil | |
| COC(=O)C1=CC=CC=C1C(=O)OC | |
| 194.19 | |
| 17 mPa.s (20°C) | |
| 194.19 | |
| Liquid |
Safety and Handling
EINECSNumber : 205-011-6
RUO – Research Use Only