missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Dimethyl Phthalate, 99%
CAS: 131-11-3 | C10H10O4 | 194.19 g/mol
Supplier: Thermo Scientific Chemicals 116640010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Dimethyl phthalate | |
| 1.1900g/mL | |
| 150°C | |
| 98.5% min. (GC) | |
| C10H10O4 | |
| MFCD00008425 | |
| 09, 797 | |
| 15, 3279 | |
| Solubility in water: negligible. Other solubilities: miscible with organic solvents,insoluble in paraffinic hydrocarbons,slightly soluble in mineral oil | |
| COC(=O)C1=CC=CC=C1C(=O)OC | |
| 194.19 | |
| 17 mPa.s (20°C) | |
| 194.19 | |
| Liquid |
| 131-11-3 | |
| 282°C | |
| Authentic | |
| Glass bottle | |
| 1.5140 to 1.516 | |
| 1 L | |
| 1.19 | |
| dimethyl phthalate, dimethylphthalate, solvanom, solvarone, avolin, fermine, phthalic acid dimethyl ester, mipax, palatinol m, unimoll dm | |
| NIQCNGHVCWTJSM-UHFFFAOYSA-N | |
| dimethyl benzene-1,2-dicarboxylate | |
| 8554 | |
| CHEBI:4609 | |
| 99% |
Chemical Identifiers
| 131-11-3 | |
| 194.19 | |
| NIQCNGHVCWTJSM-UHFFFAOYSA-N | |
| 8554 | |
| dimethyl benzene-1,2-dicarboxylate |
| C10H10O4 | |
| MFCD00008425 | |
| dimethyl phthalate, dimethylphthalate, solvanom, solvarone, avolin, fermine, phthalic acid dimethyl ester, mipax, palatinol m, unimoll dm | |
| CHEBI:4609 | |
| COC(=O)C1=CC=CC=C1C(=O)OC |
Safety and Handling
EINECSNumber : 205-011-6
RUO – Research Use Only