missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzethonium Chloride, USP, 97-103%, Spectrum™ Chemical
BE129, 121-54-0, C27H42ClNO2
Supplier: Spectrum Chemical Mfg Cor BE12912KGBL
Description
Spectrum™ Chemical Benzethonium Chloride, USP exhibits a broad spectrum of microbiocidal activity against bacteria, fungi, mold and viruses. All Spectrum Chemical USP products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 121-54-0 | |
| 0.1% | |
| Amber Glass Bottle | |
| 12 kg | |
| UREZNYTWGJKWBI-UHFFFAOYSA-M | |
| benzyldimethyl(2-{2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy}ethyl)azanium chloride | |
| 97 to 103% | |
| Crystalline Powder or Lumps |
| 100% | |
| 5% | |
| C27H42ClNO2 | |
| UN3261 | |
| [Cl-].CC(C)(C)CC(C)(C)C1=CC=C(OCCOCC[N+](C)(C)CC2=CC=CC=C2)C=C1 | |
| 448.09 | |
| USP |
Chemical Identifiers
| 121-54-0 | |
| 448.09 | |
| benzyldimethyl(2-{2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy}ethyl)azanium chloride |
| C27H42ClNO2 | |
| UREZNYTWGJKWBI-UHFFFAOYSA-M | |
| [Cl-].CC(C)(C)CC(C)(C)C1=CC=C(OCCOCC[N+](C)(C)CC2=CC=CC=C2)C=C1 |