missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Trimethyl 1,3,5-benzenetricarboxylate, 99%
CAS: 2672-58-4 | C12H12O6 | 252.22 g/mol
$211.78 - $698.73
Chemical Identifiers
| CAS | 2672-58-4 |
|---|---|
| Molecular Formula | C12H12O6 |
| Molecular Weight (g/mol) | 252.22 |
| MDL Number | MFCD00008434 |
| InChI Key | RGCHNYAILFZUPL-UHFFFAOYSA-N |
| Synonym | trimethyl 1,3,5-benzenetricarboxylate, trimethyl trimesate, trimesic acid trimethyl ester, 1,3,5-benzenetricarboxylic acid, trimethyl ester, 1,3,5-benzenetricarboxylic acid trimethyl ester, trimethylbenzene-1,3,5-tricarboxylate, 1,3,5-trimethyl benzene-1,3,5-tricarboxylate, methyl 3,5-bis methoxycarbonyl benzoate, benzene-1,3,5-tricarboxylic acid trimethyl ester, timtec-bb sbb007766 |
| PubChem CID | 75881 |
| IUPAC Name | trimethyl benzene-1,3,5-tricarboxylate |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(=O)OC)C(=O)OC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC152070250
|
Thermo Scientific Chemicals
152070250 |
25 g | Glass bottle |
Each for $211.78
|
|
||||
|
AC152071000
|
Thermo Scientific Chemicals
152071000 |
100 g | Glass bottle |
Each for $698.73
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2672-58-4 | |
| 252.22 | |
| RGCHNYAILFZUPL-UHFFFAOYSA-N | |
| 75881 | |
| COC(=O)C1=CC(=CC(=C1)C(=O)OC)C(=O)OC |
| C12H12O6 | |
| MFCD00008434 | |
| trimethyl 1,3,5-benzenetricarboxylate, trimethyl trimesate, trimesic acid trimethyl ester, 1,3,5-benzenetricarboxylic acid, trimethyl ester, 1,3,5-benzenetricarboxylic acid trimethyl ester, trimethylbenzene-1,3,5-tricarboxylate, 1,3,5-trimethyl benzene-1,3,5-tricarboxylate, methyl 3,5-bis methoxycarbonyl benzoate, benzene-1,3,5-tricarboxylic acid trimethyl ester, timtec-bb sbb007766 | |
| trimethyl benzene-1,3,5-tricarboxylate |
Specifications
| 2672-58-4 | |
| White | |
| 98.5% min. (GC) | |
| C12H12O6 | |
| MFCD00008434 | |
| 09, 979 | |
| RGCHNYAILFZUPL-UHFFFAOYSA-N | |
| trimethyl benzene-1,3,5-tricarboxylate | |
| 75881 | |
| 99% | |
| Trimethyl 1,3,5-benzenetricarboxylate |
| 144°C to 147°C | |
| Authentic | |
| Glass bottle | |
| C6H3(CO2CH3)3 | |
| 25 g | |
| trimethyl 1,3,5-benzenetricarboxylate, trimethyl trimesate, trimesic acid trimethyl ester, 1,3,5-benzenetricarboxylic acid, trimethyl ester, 1,3,5-benzenetricarboxylic acid trimethyl ester, trimethylbenzene-1,3,5-tricarboxylate, 1,3,5-trimethyl benzene-1,3,5-tricarboxylate, methyl 3,5-bis methoxycarbonyl benzoate, benzene-1,3,5-tricarboxylic acid trimethyl ester, timtec-bb sbb007766 | |
| COC(=O)C1=CC(=CC(=C1)C(=O)OC)C(=O)OC | |
| 252.22 | |
| 252.22 | |
| Crystalline Powder or Crystals |
Safety and Handling
EINECSNumber : 220-215-5
RUO – Research Use Only