missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triflumuron, 98+%, Thermo Scientific Chemicals
Triflumuron acts as a chitin synthesis inhibitor and prevents uridine incorporation into RNA
$686.01 - $686.01
Chemical Identifiers
| CAS | 64628-44-0 |
|---|---|
| Molecular Formula | C15H10ClF3N2O3 |
| Molecular Weight (g/mol) | 358.701 |
| MDL Number | MFCD00072496 |
| InChI Key | XAIPTRIXGHTTNT-UHFFFAOYSA-N |
| Synonym | triflumuron, alsystin, trifluron, mascot, alsystine, triflumuron iso, caswell no. 217c, bay-sir 8514, unii-3ft64dyg8k, bay-vi 7533 |
| PubChem CID | 47445 |
| ChEBI | CHEBI:39388 |
| IUPAC Name | 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide |
| SMILES | C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6311222
|
Thermo Scientific Chemicals
J6311222 |
100 g |
Each for $686.01
|
|
|||||
Description
Triflumuron acts as a chitin synthesis inhibitor and prevents uridine incorporation into RNA
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 64628-44-0 | |
| 358.701 | |
| XAIPTRIXGHTTNT-UHFFFAOYSA-N | |
| 47445 | |
| 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide |
| C15H10ClF3N2O3 | |
| MFCD00072496 | |
| triflumuron, alsystin, trifluron, mascot, alsystine, triflumuron iso, caswell no. 217c, bay-sir 8514, unii-3ft64dyg8k, bay-vi 7533 | |
| CHEBI:39388 | |
| C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)Cl |
Specifications
| 64628-44-0 | |
| C15H10ClF3N2O3 | |
| 100 g | |
| 14,9678 | |
| Soluble in DMF | |
| C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)Cl | |
| 358.701 | |
| CHEBI:39388 | |
| ≥98% | |
| Triflumuron |
| 198°C | |
| MFCD00072496 | |
| 2776684 | |
| triflumuron, alsystin, trifluron, mascot, alsystine, triflumuron iso, caswell no. 217c, bay-sir 8514, unii-3ft64dyg8k, bay-vi 7533 | |
| XAIPTRIXGHTTNT-UHFFFAOYSA-N | |
| 2-chloro-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]benzamide | |
| 47445 | |
| 358.7 | |
| Solid |
Safety and Handling
EINECSNumber : 264-980-3
RTECSNumber : CV2474000
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only