missing translation for 'onlineSavingsMsg'
Learn More
Learn More
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic Acid Monohydrate, 98%
trans-1,2-Diaminocyclohexane-N,N,N,N-tetraacetic acid monohydrate, 98%, C14H24N2O9, CAS Number-125572-95-4 | CAS: 125572-95-4 | C14H20N2O8 | 344.32 g/mol
$142.18 - $6227.23
Chemical Identifiers
| CAS | 125572-95-4 |
|---|---|
| Molecular Formula | C14H20N2O8 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, dcyta, trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate, 1,2-cyclohexanedinitrilotetraacetic acid, 2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, trans-1,2-cyclohexanediaminetetraacetic acid monohydrate, cdta monohydrate, ctda monohydrate, chel-cd, chel r-cd |
| PubChem CID | 2723844 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC155000250
|
Thermo Scientific Chemicals
155000250 |
25 g |
Each for $142.18
|
|
|||||
|
AC155005000
|
Thermo Scientific Chemicals
155005000 |
500 g |
Each for $1,557.60
|
|
|||||
|
AC155000025
|
Thermo Scientific Chemicals
155000025 |
2.5 kg |
Each for $6,227.23
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chelation/Complexation reagentChemical Identifiers
| 125572-95-4 | |
| 344.32 | |
| FCKYPQBAHLOOJQ-NXEZZACHSA-L | |
| 2723844 |
| C14H20N2O8 | |
| MFCD00149243,MFCD00066429,MFCD00003845 | |
| 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, dcyta, trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate, 1,2-cyclohexanedinitrilotetraacetic acid, 2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, trans-1,2-cyclohexanediaminetetraacetic acid monohydrate, cdta monohydrate, ctda monohydrate, chel-cd, chel r-cd | |
| [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
Specifications
| 125572-95-4 | |
| White | |
| 97.5% min. (Complexometry) | |
| C14H20N2O8 | |
| MFCD00149243,MFCD00066429,MFCD00003845 | |
| 13,III,1 | |
| Solubility in water: insoluble. Other solubilities: insoluble in most common organic solvents, soluble in alkali solutions | |
| [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O | |
| 344.32 | |
| 364.35 | |
| Fine Crystalline Powder |
| >210.0°C | |
| Authentic | |
| Plastic Bottle | |
| C6H10[N(CH2CO2H)2]2·H2O | |
| 25 g | |
| 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, dcyta, trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate, 1,2-cyclohexanedinitrilotetraacetic acid, 2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, trans-1,2-cyclohexanediaminetetraacetic acid monohydrate, cdta monohydrate, ctda monohydrate, chel-cd, chel r-cd | |
| FCKYPQBAHLOOJQ-NXEZZACHSA-L | |
| 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate | |
| 2723844 | |
| 98% | |
| trans-1,2-Diaminocyclohexane-N,N,N′,N′-tetraacetic acid monohydrate |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Wash face,hands and any exposed skin thoroughly after handling.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for bre
GHS Signal Word: Warning
RUO – Research Use Only