missing translation for 'onlineSavingsMsg'
Learn More
Learn More

Starch, Soluble (Powder/Certified ACS), Fisher Chemical™
For iodometry
Supplier: Thermo Fisher Scientific S516500
Specifications
White | |
5.0 to 7.0 | |
9005-84-9 | |
C12H22O11 | |
1.0384g/cm³ | |
500 g | |
C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O | |
342.297 | |
CHEBI:18167 | |
Pass Test | |
Glass Bottle |
Starch, Soluble | |
Powder/Solid | |
256°C | |
MFCD00082026 | |
alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
GUBGYTABKSRVRQ-ASMJPISFSA-N | |
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol | |
439341 | |
Certified ACS | |
0.4% max. | |
Pass Test |
Chemical Identifiers
9005-84-9 | |
342.297 | |
GUBGYTABKSRVRQ-ASMJPISFSA-N | |
439341 | |
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
C12H22O11 | |
MFCD00082026 | |
alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
CHEBI:18167 | |
C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
Safety and Handling
