missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sodium 1-pentanesulfonate monohydrate, HPLC grade
Ion pair reagent | CAS: 207605-40-1 | C5H13NaO4S | 192.205 g/mol
$98.07 - $998.63
Chemical Identifiers
| CAS | 207605-40-1 |
|---|---|
| Molecular Formula | C5H13NaO4S |
| Molecular Weight (g/mol) | 192.205 |
| MDL Number | MFCD00007541 |
| InChI Key | FPQYXAFKHLSWTI-UHFFFAOYSA-M |
| Synonym | sodium pentane-1-sulfonate hydrate, 1-pentanesulfonic acid sodium salt monohydrate, sodium 1-pentanesulfonate monohydrate, potassium hydrate pentane-1-sulfonate, sodium 1-pentanesulfonate hydrate, sodium hydrate pentane-1-sulfonate, sodium pentane-1-sulfonate-water 1/1/1, 1-pentane sulphonic acid sodium salt monohydrate, 1-pentanesulfonic acid sodium salt monohydydrate, sodium 1-pentanesulfonate monohydrate, hplc grade |
| PubChem CID | 23693099 |
| IUPAC Name | sodium;pentane-1-sulfonate;hydrate |
| SMILES | CCCCCS(=O)(=O)[O-].O.[Na+] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AA1571406
|
Thermo Scientific Chemicals
01571406 |
5 g |
Each for $98.07
|
|
|||||
|
AA1571414
|
Thermo Scientific Chemicals
01571414 |
25 g |
Each for $293.51
|
|
|||||
|
AA1571422
|
Thermo Scientific Chemicals
01571422 |
100 g |
Each for $998.63
|
|
|||||
Description
Ion pair reagent.Sodium 1-pentanesulfonate monohydrate is used as a surfactant and a reversed-phase ion-pairing agent. It is utilized to study its effects on the properties of polyaniline, using Fourier transform infrared and UV-visible spectroscopy. Further, it is used for HPLC analysis of proteins and peptides.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 207605-40-1 | |
| 192.205 | |
| FPQYXAFKHLSWTI-UHFFFAOYSA-M | |
| 23693099 | |
| CCCCCS(=O)(=O)[O-].O.[Na+] |
| C5H13NaO4S | |
| MFCD00007541 | |
| sodium pentane-1-sulfonate hydrate, 1-pentanesulfonic acid sodium salt monohydrate, sodium 1-pentanesulfonate monohydrate, potassium hydrate pentane-1-sulfonate, sodium 1-pentanesulfonate hydrate, sodium hydrate pentane-1-sulfonate, sodium pentane-1-sulfonate-water 1/1/1, 1-pentane sulphonic acid sodium salt monohydrate, 1-pentanesulfonic acid sodium salt monohydydrate, sodium 1-pentanesulfonate monohydrate, hplc grade | |
| sodium;pentane-1-sulfonate;hydrate |
Specifications
| 207605-40-1 | |
| C5H13NaO4S | |
| MFCD00007541 | |
| 3725147 | |
| Soluble in water. | |
| CCCCCS(=O)(=O)[O-].O.[Na+] | |
| 192.205 | |
| 192.21 (174.19 Anhydrous) | |
| Crystalline Powder |
| White | |
| CH3(CH2)4SO3Na·H2O | |
| 5 g | |
| sodium pentane-1-sulfonate hydrate, 1-pentanesulfonic acid sodium salt monohydrate, sodium 1-pentanesulfonate monohydrate, potassium hydrate pentane-1-sulfonate, sodium 1-pentanesulfonate hydrate, sodium hydrate pentane-1-sulfonate, sodium pentane-1-sulfonate-water 1/1/1, 1-pentane sulphonic acid sodium salt monohydrate, 1-pentanesulfonic acid sodium salt monohydydrate, sodium 1-pentanesulfonate monohydrate, hplc grade | |
| FPQYXAFKHLSWTI-UHFFFAOYSA-M | |
| sodium;pentane-1-sulfonate;hydrate | |
| 23693099 | |
| HPLC | |
| Sodium 1-pentanesulfonate monohydrate |
Safety and Handling
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
EINECSNumber : 245-208-4
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only