missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Selectophore™ Diphenyl ether, 99.9%, MilliporeSigma™ Supelco™
$92.59 - $92.59
Chemical Identifiers
| CAS | 101-84-8 |
|---|---|
| Molecular Formula | C12H10O |
| Molecular Weight (g/mol) | 170.21 |
| MDL Number | MFCD00003034 |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Synonym | Diphenyl oxide; Phenyl ether |
| IUPAC Name | phenoxybenzene |
| SMILES | O(C1=CC=CC=C1)C1=CC=CC=C1 |
Description
Diphenyl ether (diphenyl oxide) belongs to the family of aromatic homomonocyclic compounds. It is colorless, exists as crystalline solid or liquid (above 82F) and has a geranium-like odor. Diphenyl ether is present in alcoholic beverages. It is used as a flavouring ingredient and is found in vanilla, green tea, muscat grapes, potato chips, grilled beef, buckwheat, and lemon balm. It is a starting material in the production of phenoxathiin via the Ferrario reaction.. In similar reactions, diphenyl ether is a significant side product in the high-pressure hydrolysis of chlorobenzene during production of phenol. Also several polybrominated diphenyl ethers (PBDEs) are useful flame retardants.Chemical Identifiers
| 101-84-8 | |
| 170.21 | |
| USIUVYZYUHIAEV-UHFFFAOYSA-N | |
| phenoxybenzene |
| C12H10O | |
| MFCD00003034 | |
| Diphenyl oxide; Phenyl ether | |
| O(C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 101-84-8 | |
| 1.073 g/mL (at 25°C) | |
| C12H10O | |
| n20/D 1.579 | |
| 25 mL | |
| USIUVYZYUHIAEV-UHFFFAOYSA-N | |
| phenoxybenzene | |
| >5.86 (25°C, vs. air) | |
| <1 mmHg (20°C) | |
| Selectophore™ |
| 25°C to 27°C; 27°C to 29°C | |
| 259°C | |
| (C6H5)2 O | |
| MFCD00003034 | |
| Diphenyl oxide; Phenyl ether | |
| O(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 170.21 | |
| 170.21 | |
| ≥99.9% | |
| Selectophore |
Safety and Handling
RTECSNumber : KN8970000
Selectophore is a trademark of Sigma-Aldrich Chemie GmbH