missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate, 0.500 N (N/2), Ricca Chemical
$144.25 - $237.06
Chemical Identifiers
CAS | 7778-50-9 |
---|---|
Molecular Formula | Cr2K2O7 |
Molecular Weight (g/mol) | 294.182 |
InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
Synonym | potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash |
PubChem CID | 24502 |
ChEBI | CHEBI:53444 |
IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Chemical Identifiers
7778-50-9 | |
294.182 | |
potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
CHEBI:53444 | |
[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Cr2K2O7 | |
KMUONIBRACKNSN-UHFFFAOYSA-N | |
24502 | |
dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Specifications
Orange | |
96.0,2.35 | |
Cr2K2O7 | |
KMUONIBRACKNSN-UHFFFAOYSA-N | |
dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
24502 | |
Laboratory | |
∼3.5 to 4 | |
Liquid | |
Potassium Dichromate |
7778-50-9,7732-18-5 | |
100.0,2.44 | |
potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
294.182 | |
CHEBI:53444 | |
Natural Poly Bottle | |
500 mL | |
0.500Normal |