missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Biiodate, Certified, 0.0250N ±0.0005N (0.0021M), LabChem™
$106.00 - $241.43
Chemical Identifiers
CAS | 13455-24-8 |
---|---|
Molecular Formula | HI2KO6 |
Molecular Weight (g/mol) | 389.909 |
InChI Key | ACAYDTMSDROWHW-UHFFFAOYSA-M |
Synonym | potassium hydrogen diiodate, potassium biiodate, kaliumhydrogendijodat, iodic acid hio3 , potassium salt 2:1, potassium biiodate solution, potassium iodic acid iodate, io3.k.hio3, potassium ion iodic acid iodate, potassium hydrogen iodate powder, potassium hydrogen diiodate, p.a |
PubChem CID | 23700942 |
IUPAC Name | potassium;iodic acid;iodate |
SMILES | OI(=O)=O.[O-]I(=O)=O.[K+] |
Chemical Identifiers
13455-24-8 | |
389.909 | |
potassium hydrogen diiodate, potassium biiodate, kaliumhydrogendijodat, iodic acid hio3 , potassium salt 2:1, potassium biiodate solution, potassium iodic acid iodate, io3.k.hio3, potassium ion iodic acid iodate, potassium hydrogen iodate powder, potassium hydrogen diiodate, p.a | |
potassium;iodic acid;iodate |
HI2KO6 | |
ACAYDTMSDROWHW-UHFFFAOYSA-M | |
23700942 | |
OI(=O)=O.[O-]I(=O)=O.[K+] |
Specifications
13455-24-8,7732-18-5 | |
99.92,0.08 | |
1 L | |
KHI2O6 | |
Soluble in water | |
OI(=O)=O.[O-]I(=O)=O.[K+] | |
389.909 | |
389.92 | |
0.0250N ±0.0005N (0.0021M) | |
Poly Bottle | |
Iodine vapor | |
Potassium Biiodate |
Colorless | |
Liquid | |
HI2KO6 | |
potassium hydrogen diiodate, potassium biiodate, kaliumhydrogendijodat, iodic acid hio3 , potassium salt 2:1, potassium biiodate solution, potassium iodic acid iodate, io3.k.hio3, potassium ion iodic acid iodate, potassium hydrogen iodate powder, potassium hydrogen diiodate, p.a | |
ACAYDTMSDROWHW-UHFFFAOYSA-M | |
potassium;iodic acid;iodate | |
23700942 | |
Certified | |
Passes Test | |
1g/mL | |
1g/mL |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature