missing translation for 'onlineSavingsMsg'
Learn More
Learn More

Phenolphthalein Solution, Alcoholic, 1.0%, Fisher Chemical™
Volumetric indicator
Supplier: Fisher Chemical FLSP62500
Specifications
Phenolphthalein Solution, Alcoholic 1.0% | |
83°C | |
0.7 to 1.3% | |
MFCD00005913 | |
OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 | |
318.33 | |
CHEBI:34914 | |
Glass Bottle | |
Pass Test | |
Colorless | |
Liquid |
-89°C | |
77-09-8,67-63-0 | |
C20H14O4 | |
KJFMBFZCATUALV-UHFFFAOYSA-N | |
3,3-bis(4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-1-one | |
4764 | |
1% w/v | |
40mmHg | |
0.7855g/cm³ | |
500 mL |
Chemical Identifiers
77-09-8 | |
318.33 | |
KJFMBFZCATUALV-UHFFFAOYSA-N | |
CHEBI:34914 | |
OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
C20H14O4 | |
MFCD00005913 | |
4764 | |
3,3-bis(4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-1-one |
Safety and Handling

DOTInformation : DOT Class 3, : Flammable Liquid