missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Oxonic acid, potassium salt, 97.5%
CAS: 2207-75-2 | C4H2KN3O4 | 195.18 g/mol
$686.70 - $686.70
Chemical Identifiers
| CAS | 2207-75-2 |
|---|---|
| Molecular Formula | C4H2KN3O4 |
| Molecular Weight (g/mol) | 195.18 |
| MDL Number | MFCD00010565 |
| InChI Key | IAPCTXZQXAVYNG-UHFFFAOYSA-M |
| Synonym | potassium oxonate, oteracil potassium, oxonic acid potassium salt, allantoxanic acid potassium salt, potassium azaorotate, oxonic acid, potassium salt, oxonate, potassium, oxonate, allantoxanic acid |
| PubChem CID | 2723920 |
| ChEBI | CHEBI:80230 |
| IUPAC Name | potassium;4,6-dioxo-1H-1,3,5-triazine-2-carboxylate |
| SMILES | [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC168531000
|
Thermo Scientific Chemicals
168531000 |
100 g | Glass bottle |
Each for $686.70
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2207-75-2 | |
| 195.18 | |
| IAPCTXZQXAVYNG-UHFFFAOYSA-M | |
| 2723920 | |
| potassium;4,6-dioxo-1H-1,3,5-triazine-2-carboxylate |
| C4H2KN3O4 | |
| MFCD00010565 | |
| potassium oxonate, oteracil potassium, oxonic acid potassium salt, allantoxanic acid potassium salt, potassium azaorotate, oxonic acid, potassium salt, oxonate, potassium, oxonate, allantoxanic acid | |
| CHEBI:80230 | |
| [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1 |
Specifications
| 2207-75-2 | |
| White | |
| 97.5% | |
| C4H2KN3O4 | |
| 100 g | |
| potassium oxonate, oteracil potassium, oxonic acid potassium salt, allantoxanic acid potassium salt, potassium azaorotate, oxonic acid, potassium salt, oxonate, potassium, oxonate, allantoxanic acid | |
| [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1 | |
| 195.18 | |
| CHEBI:80230 | |
| 97.5% | |
| Oxonic acid, potassium salt, 97.5% |
| >300.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00010565 | |
| 24, 451 | |
| IAPCTXZQXAVYNG-UHFFFAOYSA-M | |
| potassium;4,6-dioxo-1H-1,3,5-triazine-2-carboxylate | |
| 2723920 | |
| 195.18 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 218-627-5
RTECSNumber : RR4580000
RUO – Research Use Only