missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Organic Carbon Standard, 100 ppm C, Ricca Chemical
Supplier: Ricca Chemical Company R1846000250C
Specifications
| Organic Carbon Standard, 100 ppm C | |
| 7732-18-5,7664-38-2,877-24-7 | |
| 99.58,0.4,0.02 | |
| Liquid | |
| Colorless | |
| 0°C | |
| Miscible with water | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 250 mL | |
| Laboratory |
| Amber Glass Bottle | |
| 99.58,0.4,0.02 | |
| 1.001 | |
| C8H5KO4 | |
| < 2 | |
| 100°C | |
| Standard | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 23676735 |
Chemical Identifiers
| 7732-18-5 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate |
| C8H5KO4 | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Safety and Handling
ShelfLife : 12 months
Recommended Storage : Ambient