missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Organic Carbon Standard, 5 ppm C, Ricca Chemical
Supplier: Ricca Chemical Company R18440504C
Specifications
| Organic Carbon Standard | |
| Amber Glass Bottle | |
| Odorless | |
| Liquid | |
| Colorless to Yellow | |
| 0.0°C | |
| GC, GC/MS, HPLC, LC/MS, and Other Analytical Instrumentation | |
| Calibration Standard | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| Water | |
| Mixture | |
| 23676735 |
| 1mL = 0.005mg C, 5ppm C for Total Organic Carbon (TOC) | |
| 7732-18-5,7664-38-2,877-24-7 | |
| 5.00 ± 0.05ppm | |
| C8H5KO4 | |
| <2 | |
| 100°C | |
| Infinitely soluble in water | |
| Standard | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| potassium;2-carboxybenzoate | |
| 4 L | |
| Laboratory |
Chemical Identifiers
| 7732-18-5 | |
| Mixture | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate |