missing translation for 'onlineSavingsMsg'
Learn More
Learn More
O-Methylisourea hemisulfate, 94%
CAS: 52328-05-9 | 0·5 H2SO4 | 123.12 g/mol
$143.25 - $143.25
Chemical Identifiers
| CAS | 52328-05-9 |
|---|---|
| Molecular Formula | 0·5 H2SO4 |
| Molecular Weight (g/mol) | 123.12 |
| MDL Number | MFCD00040594 |
| InChI Key | QSCPQKVWSNUJLJ-UHFFFAOYSA-N |
| Synonym | o-methylisourea hemisulfate, 2-methylisouronium sulfate, o-methylisourea hemisulfate salt, bis methoxymethanimidamide ; sulfuric acid, carbamimidic acid, methyl ester, sulfate 2:1, omi™, o-methylpseudourea sulfate, 0-methylisourea hemisulfate, o-methylisourea hemisulphate, bis 2-methylisouronium sulphate |
| PubChem CID | 11357018 |
| IUPAC Name | methyl carbamimidate;sulfuric acid |
| SMILES | COC(=N)N.COC(=N)N.OS(=O)(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC233030250
|
Thermo Scientific Chemicals
233030250 |
25 g |
Each for $143.25
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 52328-05-9 | |
| 123.12 | |
| QSCPQKVWSNUJLJ-UHFFFAOYSA-N | |
| 11357018 | |
| COC(=N)N.COC(=N)N.OS(=O)(=O)O |
| 0·5 H2SO4 | |
| MFCD00040594 | |
| o-methylisourea hemisulfate, 2-methylisouronium sulfate, o-methylisourea hemisulfate salt, bis methoxymethanimidamide ; sulfuric acid, carbamimidic acid, methyl ester, sulfate 2:1, omi™, o-methylpseudourea sulfate, 0-methylisourea hemisulfate, o-methylisourea hemisulphate, bis 2-methylisouronium sulphate | |
| methyl carbamimidate;sulfuric acid |
Specifications
| 52328-05-9 | |
| 100.0 | |
| 94% | |
| 0·5 H2SO4 | |
| MFCD00040594 | |
| o-methylisourea hemisulfate, 2-methylisouronium sulfate, o-methylisourea hemisulfate salt, bis methoxymethanimidamide ; sulfuric acid, carbamimidic acid, methyl ester, sulfate 2:1, omi™, o-methylpseudourea sulfate, 0-methylisourea hemisulfate, o-methylisourea hemisulphate, bis 2-methylisouronium sulphate | |
| QSCPQKVWSNUJLJ-UHFFFAOYSA-N | |
| methyl carbamimidate;sulfuric acid | |
| 11357018 | |
| 94% |
| 92.0 | |
| 147°C to 153°C | |
| Plastic bottle | |
| 0·5H2SO4 | |
| 25 g | |
| Solubility in water: 1000g/L water (20°C) | |
| COC(=N)N.COC(=N)N.OS(=O)(=O)O | |
| 123.12 | |
| 123.12 | |
| O-Methylisourea hemisulfate, 94% |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 257-851-8
RUO – Research Use Only