missing translation for 'onlineSavingsMsg'
Learn More
Learn More
LiChropur™ Trifluoroacetic Anhydride, For GC derivatization, 99.0% (GC), MilliporeSigma™ Supelco™
Reagent for cabethoxy, butyl ester, n-methyl, methyl ester, di(trifluoroacetyl), hexafluoroisopropyl ester, acetyl or trifluoroacetyl phenylthihydantoins, trifluoroacetyl (2-hydroxy-2-methyl)ethyl, n-trifluoroacetyl, trifluoroacetyl (TFA), trifluoroacetamide, 4-trifluoromethyl-2, 6-diamino-1,3,5-triazineacetyl and trifluoroacetyl vanillin.
Supplier: Merck Emd Millipore 9171950ML
Specifications
| -65°C | |
| 39.5°C to 40°C | |
| (CF3CO)2 O | |
| TFAA | |
| FC(F)(F)C(=O)OC(=O)C(F)(F)F | |
| 210.03 | |
| ≥99.0% (GC) | |
| 1.511 g/mL (at 20°C) | |
| n20/D 1.3 |
| 407-25-0 | |
| C4F6O3 | |
| MFCD00000416 | |
| QAEDZJGFFMLHHQ-UHFFFAOYSA-N | |
| 2,2,2-trifluoroacetyl 2,2,2-trifluoroacetate | |
| 210.03 | |
| GC/MS (SIM) | |
| 50 mL | |
| 6.28 psi (20°C) |
Chemical Identifiers
| 407-25-0 | |
| 210.03 | |
| QAEDZJGFFMLHHQ-UHFFFAOYSA-N | |
| 2,2,2-trifluoroacetyl 2,2,2-trifluoroacetate |
| C4F6O3 | |
| MFCD00000416 | |
| TFAA | |
| FC(F)(F)C(=O)OC(=O)C(F)(F)F |
Safety and Handling
RTECSNumber : AJ9800000
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany