missing translation for 'onlineSavingsMsg'
Learn More
Learn More
LiChropur™ N,O-Bis(trimethylsilyl)trifluoroacetamide with trimethylchlorosilane, 99% (excluding TMCS), MilliporeSigma™ Supelco™
For GC Derivatization, Contains 1% TMCS
Supplier: Merck Emd Millipore 1523810X01ML
Description
Silylating mixture used for the silylation of various compoundsSpecifications
25561-30-2 | |
45°C to 50°C (14 mmHg) | |
C8H18F3NOSi2 | |
n20/D 1.384 | |
10 x 0.1 mL | |
XCOBLONWWXQEBS-UHFFFAOYSA-N | |
trimethylsilyl 2,2,2-trifluoro-N-(trimethylsilyl)ethanimidate | |
257.40 | |
For GC derivatization |
0.97 g/mL | |
Glass Bottle | |
CF3C[=NSi(CH3)3 ]OSi(CH3)3 | |
MFCD00008269 | |
Silylating mixture V; BSTFA + TMCS | |
C[Si](C)(C)OC(=N[Si](C)(C)C)C(F)(F)F | |
257.40 | |
99% (excluding TMCS) | |
LiChropur |
Chemical Identifiers
25561-30-2 | |
257.40 | |
XCOBLONWWXQEBS-UHFFFAOYSA-N | |
trimethylsilyl 2,2,2-trifluoro-N-(trimethylsilyl)ethanimidate |
C8H18F3NOSi2 | |
MFCD00008269 | |
Silylating mixture V; BSTFA + TMCS | |
C[Si](C)(C)OC(=N[Si](C)(C)C)C(F)(F)F |
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany