missing translation for 'onlineSavingsMsg'
Learn More
Learn More
LiChropur™ ™-(-)-α-Methoxy-α-(trifluoromethyl)phenylacetyl chloride, 99.0%, MilliporeSigma™ Supelco™
For Chiral Derivatization
Supplier: Merck Emd Millipore 65363500MG
Description
™-(-)-a-Methoxy-a-(trifluoromethyl)phenylacetyl chloride (Mosher's acid chloride) is generally used as a chiral derivatizing agent. It is easily available in enantiomerically pure form. It can form diastereomers with both alcohols and amines.Specifications
| 39637-99-5 | |
| 213°C to 214°C | |
| C10H8ClF3O2 | |
| n20/D 1.469; n20/D 1.47 | |
| 500 mg | |
| PAORVUMOXXAMPL-VIFPVBQESA-N | |
| (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride | |
| 252.62 | |
| For chiral derivatization |
| 1.35 g/mL (at 25°C) | |
| Bottomless Glass Bottle with Fused Cone | |
| C6H5C(OCH3)(CF3)COCl | |
| MFCD00044400 | |
| (R)-(-)-MTPA-Cl; Mosher's acid chloride | |
| CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F | |
| 252.62 | |
| ≥99.0% (AT) | |
| LiChropur |
Chemical Identifiers
| 39637-99-5 | |
| 252.62 | |
| PAORVUMOXXAMPL-VIFPVBQESA-N | |
| (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| C10H8ClF3O2 | |
| MFCD00044400 | |
| (R)-(-)-MTPA-Cl; Mosher's acid chloride | |
| CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F |
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany