missing translation for 'onlineSavingsMsg'
Learn More
Learn More

Ethylenediamine Tetraacetic Acid (Certified ACS), Fisher Chemical™
Supplier: Thermo Fisher Scientific E478500
Specifications
Ethylenediamine Tetraacetic Acid | |
220°C | |
0.86g/mL | |
0.2% max. | |
Glass Bottle | |
(HOOCCH2)2NCH2CH2N(CH2COOH)2 | |
500 g | |
0.005% max. Insoluble in NH4OH | |
OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
292.24 | |
CHEBI:42191 | |
0.013 hPa at 20°C | |
Certified ACS |
60-00-4 | |
White | |
2.5 | |
99.4 to 100.6% | |
C10H16N2O8 | |
MFCD00003541 | |
edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid | |
6049 | |
292.25 | |
99.4 to 100.6% | |
Powder or Solid |
Chemical Identifiers
60-00-4 | |
292.24 | |
KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
6049 | |
2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
C10H16N2O8 | |
MFCD00003541 | |
edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
CHEBI:42191 | |
OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Safety and Handling
