missing translation for 'onlineSavingsMsg'
Learn More
Learn More
DL-Histidine hydrochloride, monohydrate, 98%
CAS: 123333-71-1 | C6H10ClN3O2 | 191.62 g/mol
$467.15 - $467.15
Chemical Identifiers
| CAS | 123333-71-1 |
|---|---|
| Molecular Formula | C6H10ClN3O2 |
| Molecular Weight (g/mol) | 191.62 |
| MDL Number | MFCD00064555 |
| InChI Key | QZNNVYOVQUKYSC-JEDNCBNOSA-N |
| Synonym | hydrogen dl-histidine chloride, 2-amino-3-1h-imidazol-5-yl propanoic acid; hydron; chloride, 2-azanyl-3-1h-imidazol-5-yl propanoic acid; hydron; chloride |
| PubChem CID | 53395185 |
| IUPAC Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydron;chloride |
| SMILES | [H+].[Cl-].N[C@@H](CC1=CN=CN1)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC411721000
|
Thermo Scientific Chemicals
411721000 |
100 g | Glass Bottle |
Each for $467.15
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 123333-71-1 | |
| 191.62 | |
| QZNNVYOVQUKYSC-JEDNCBNOSA-N | |
| 53395185 | |
| [H+].[Cl-].N[C@@H](CC1=CN=CN1)C(O)=O |
| C6H10ClN3O2 | |
| MFCD00064555 | |
| hydrogen dl-histidine chloride, 2-amino-3-1h-imidazol-5-yl propanoic acid; hydron; chloride, 2-azanyl-3-1h-imidazol-5-yl propanoic acid; hydron; chloride | |
| 2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydron;chloride |
Specifications
| 233.0°C | |
| 1ppm max. | |
| 10ppm max. | |
| 10ppm max. | |
| 98% | |
| C6H10ClN3O2 | |
| MFCD00064555 | |
| 96% min. (c=3, H2O, 430nm) 1cm cell | |
| hydrogen dl-histidine chloride, 2-amino-3-1h-imidazol-5-yl propanoic acid; hydron; chloride, 2-azanyl-3-1h-imidazol-5-yl propanoic acid; hydron; chloride | |
| [H+].[Cl-].N[C@@H](CC1=CN=CN1)C(O)=O | |
| 191.62 | |
| 53395185 | |
| 98% | |
| DL-Histidine hydrochloride, monohydrate, 98% |
| 123333-71-1 | |
| White | |
| Authentic | |
| 1% max. | |
| (TLC) none | |
| Glass Bottle | |
| 300ppm max. | |
| 0.1% max. | |
| QZNNVYOVQUKYSC-JEDNCBNOSA-N | |
| 2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydron;chloride | |
| 100 g | |
| 209.64 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 229-266-8
TSCA : TSCA
RUO – Research Use Only