missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Diltiazem hydrochloride, 98%
CAS: 33286-22-5 | C22H26N2O4S·HCl | 450.99 g/mol
$74.45 - $74.45
Chemical Identifiers
| CAS | 33286-22-5 |
|---|---|
| Molecular Formula | C22H26N2O4S·HCl |
| Molecular Weight (g/mol) | 450.99 |
| MDL Number | MFCD00069252 |
| InChI Key | HDRXZJPWHTXQRI-BHDTVMLSSA-N |
| Synonym | diltiazem hydrochloride, diltiazem hcl, herbesser, dilzene, lacerol, masdil, tildiem, tiazac, mono-tildiem, bi-tildiem |
| PubChem CID | 62920 |
| ChEBI | CHEBI:645509 |
| IUPAC Name | [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride |
| SMILES | CC(=O)OC1C(SC2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC329080010
|
Thermo Scientific Chemicals
329080010 |
1 g | Glass bottle |
Each for $74.45
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 33286-22-5 | |
| 450.99 | |
| HDRXZJPWHTXQRI-BHDTVMLSSA-N | |
| 62920 | |
| [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride |
| C22H26N2O4S·HCl | |
| MFCD00069252 | |
| diltiazem hydrochloride, diltiazem hcl, herbesser, dilzene, lacerol, masdil, tildiem, tiazac, mono-tildiem, bi-tildiem | |
| CHEBI:645509 | |
| CC(=O)OC1C(SC2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC.Cl |
Specifications
| 33286-22-5 | |
| White | |
| 0.5% max. | |
| 97.5% min. (HPLC) | |
| C22H26N2O4S·HCl | |
| 1 g | |
| diltiazem hydrochloride, diltiazem hcl, herbesser, dilzene, lacerol, masdil, tildiem, tiazac, mono-tildiem, bi-tildiem | |
| HDRXZJPWHTXQRI-BHDTVMLSSA-N | |
| [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride | |
| 62920 | |
| 450.99 | |
| Powder |
| 210.0°C to 215.0°C | |
| 0.1% max. | |
| Authentic | |
| Glass bottle | |
| MFCD00069252 | |
| 15,3224 | |
| Solubility in water: soluble. Other solubilities: soluble in chloroform,formic acid,methanol | |
| CC(=O)OC1C(SC2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC.Cl | |
| 450.99 | |
| CHEBI:645509 | |
| 98% | |
| Diltiazem hydrochloride |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Warning
EINECSNumber : 251-443-3
RUO – Research Use Only