missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Diethyl acetylsuccinate, 97+%
CAS: 1115-30-6 | C10H16O5 | 216.233 g/mol
$55.25 - $418.38
Chemical Identifiers
| CAS | 1115-30-6 |
|---|---|
| Molecular Formula | C10H16O5 |
| Molecular Weight (g/mol) | 216.233 |
| MDL Number | MFCD00009157 |
| InChI Key | DVSDDICSXBCMQJ-UHFFFAOYSA-N |
| Synonym | diethyl 2-acetylsuccinate, diethyl acetylsuccinate, ethyl acetylsuccinate, diethyl acetosuccinate, butanedioic acid, acetyl-, diethyl ester, acetylsuccinic acid diethyl ester, diethylacetylsuccinate, 1,4-diethyl 2-acetylbutanedioate, succinic acid, acetyl-, diethyl ester, butanedioic acid, 2-acetyl-, 1,4-diethyl ester |
| PubChem CID | 66197 |
| IUPAC Name | diethyl 2-acetylbutanedioate |
| SMILES | CCOC(=O)CC(C(=O)C)C(=O)OCC |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAB2374406
|
Thermo Scientific Chemicals
B2374406 |
5 g |
Each for $55.25
|
|
|||||
|
AAB2374414
|
Thermo Scientific Chemicals
B2374414 |
25 g |
Each for $143.88
|
|
|||||
|
AAB2374422
|
Thermo Scientific Chemicals
B2374422 |
100 g |
Each for $418.38
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1115-30-6 | |
| 216.233 | |
| DVSDDICSXBCMQJ-UHFFFAOYSA-N | |
| 66197 | |
| CCOC(=O)CC(C(=O)C)C(=O)OCC |
| C10H16O5 | |
| MFCD00009157 | |
| diethyl 2-acetylsuccinate, diethyl acetylsuccinate, ethyl acetylsuccinate, diethyl acetosuccinate, butanedioic acid, acetyl-, diethyl ester, acetylsuccinic acid diethyl ester, diethylacetylsuccinate, 1,4-diethyl 2-acetylbutanedioate, succinic acid, acetyl-, diethyl ester, butanedioic acid, 2-acetyl-, 1,4-diethyl ester | |
| diethyl 2-acetylbutanedioate |
Specifications
| 1115-30-6 | |
| 1.081 | |
| >110°C (230°F) | |
| 1.4346 | |
| 5 g | |
| DVSDDICSXBCMQJ-UHFFFAOYSA-N | |
| diethyl 2-acetylbutanedioate | |
| 66197 | |
| ≥97% |
| -8°C | |
| 180°C to 183°C (50 mmHg) | |
| C10H16O5 | |
| MFCD00009157 | |
| diethyl 2-acetylsuccinate, diethyl acetylsuccinate, ethyl acetylsuccinate, diethyl acetosuccinate, butanedioic acid, acetyl-, diethyl ester, acetylsuccinic acid diethyl ester, diethylacetylsuccinate, 1,4-diethyl 2-acetylbutanedioate, succinic acid, acetyl-, diethyl ester, butanedioic acid, 2-acetyl-, 1,4-diethyl ester | |
| CCOC(=O)CC(C(=O)C)C(=O)OCC | |
| 216.233 | |
| 216.23 | |
| Diethyl acetylsuccinate |
Safety and Handling
EINECSNumber : 214-223-8
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only