missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D(-)-isovaline, 97%
CAS: 3059-97-0 | C5H11NO2 | 117.15 g/mol
Supplier: Thermo Scientific Chemicals 388032500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| D(-)-Isovaline | |
| 276°C to 278°C | |
| Authentic | |
| Glass bottle | |
| CH3CH2CNH2(CH3)COOH | |
| 250 mg | |
| -9.0° to -12.0° (20°C, 589nm) (C=1, water) | |
| Solubility in water: freely soluble. Other solubilities: soluble in alcohol,slightly soluble in ether | |
| CC[C@@](C)([NH3+])C([O-])=O | |
| 117.15 | |
| 117.15 | |
| Crystalline Powder or Needles |
| 3059-97-0 | |
| White | |
| 97% | |
| C5H11NO2 | |
| MFCD00800497 | |
| 15, 5280 | |
| d-isovaline, l-isovaline, s-2-amino-2-methylbutanoic acid, l-iso-valine, unii-ebv7h5w26h, ebv7h5w26h, isovaline, l, d--isovaline, 2s-2-amino-2-methylbutanoic acid, s-2-amino-2-methylbutyric acid | |
| GCHPUFAZSONQIV-RXMQYKEDSA-N | |
| (2S)-2-amino-2-methylbutanoic acid | |
| 6971276 | |
| 97% |
Chemical Identifiers
| 3059-97-0 | |
| 117.15 | |
| GCHPUFAZSONQIV-RXMQYKEDSA-N | |
| 6971276 | |
| CC[C@@](C)([NH3+])C([O-])=O |
| C5H11NO2 | |
| MFCD00800497 | |
| d-isovaline, l-isovaline, s-2-amino-2-methylbutanoic acid, l-iso-valine, unii-ebv7h5w26h, ebv7h5w26h, isovaline, l, d--isovaline, 2s-2-amino-2-methylbutanoic acid, s-2-amino-2-methylbutyric acid | |
| (2S)-2-amino-2-methylbutanoic acid |
RUO – Research Use Only