missing translation for 'onlineSavingsMsg'
Learn More
Learn More
alpha-Cyclodextrin hydrate, 98+%
CAS: 51211-51-9 | C36H60O30 | 972.85 g/mol
Supplier: Thermo Scientific Chemicals 227290050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chelation/Complexation reagentSpecifications
| α-Cyclodextrin hydrate | |
| 98.0 | |
| 278°C | |
| 11% max. | |
| 0.5% max. Linear oligomers (HPLC) | |
| C36H60O30 | |
| 5 g | |
| + 148 | |
| Solubility in water: 145g/L (25°C) | |
| OCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC1C(O)C2O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O | |
| 972.85 | |
| 972.85 | |
| Crystalline Powder |
| 51211-51-9 | |
| 100.0 | |
| White | |
| Authentic | |
| Glass bottle | |
| MFCD00150804 | |
| 14, 2718 | |
| alpha-cyclodextrin hydrate, water.beta-cyclodextrin, cyclohexaamylose hydrate, ^a-cyclodextrin hydrate, alpha-cyclodextrin water, 972.86 anhydrous | |
| HFHDHCJBZVLPGP-UHFFFAOYNA-N | |
| 5,10,15,20,25,30-hexakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29-dodecaoxaheptacyclo[26.2.2.2³,â¶.2â¸,¹¹.2¹³,¹â¶.2¹â¸,²¹.2²³,²â¶]dotetracontane-31,32,33,34,35,36,37,38,39,40,41,42-dodecol | |
| 60161466 | |
| 98+% |
Chemical Identifiers
| 51211-51-9 | |
| 972.85 | |
| HFHDHCJBZVLPGP-UHFFFAOYNA-N | |
| 60161466 |
| C36H60O30 | |
| MFCD00150804 | |
| alpha-cyclodextrin hydrate, water.beta-cyclodextrin, cyclohexaamylose hydrate, ^a-cyclodextrin hydrate, alpha-cyclodextrin water, 972.86 anhydrous | |
| OCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC1C(O)C2O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O |
RUO – Research Use Only