missing translation for 'onlineSavingsMsg'
Learn More
Learn More
COD Standard, 1000ppm (1mL = 1mg COD) (Potassium Acid Phthalate in Water), Certified, LabChem™
Supplier: LabChem LC132451
Specifications
| COD Standard | |
| Poly Bottle | |
| 99.61,0.09,0.3 | |
| Liquid | |
| C8H5KO4 | |
| KHC8H4O4 | |
| Soluble in water | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 23676735 | |
| Certified |
| 1000ppm (1mL = 1mg COD) (Potassium Acid Phthalate in Water) | |
| 877-24-7,7664-38-2,7732-18-5 | |
| Passes Test | |
| as COD | |
| 1000 ppm | |
| Colorless | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 500 mL | |
| 204.22 |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature