missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Carbamylcholine chloride, 98+%
CAS: 51-83-2 | C6H15ClN2O2 | 182.65 g/mol
Supplier: Thermo Scientific Chemicals 108240050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Carbamylcholine chloride | |
| 51-83-2 | |
| Crystalline Powder | |
| 99% | |
| H2NCO2CH2CH2N(CH3)3Cl | |
| 15,1781 | |
| Solubility in water: 1g/mL. Other solubilities: 1g/50 mL alcohol,1g/10 mL methanol,practically insoluble in chloroform and ether | |
| [Cl-].C[N+](C)(C)CCOC(N)=O | |
| 182.65 | |
| CHEBI:3385 | |
| 99% | |
| 2.0% max. (105°C, 2 hrs) |
| 200°C to 204°C | |
| White | |
| 5 g | |
| C6H15ClN2O2 | |
| MFCD00012011 | |
| carbachol, carbamoylcholine chloride, carbachol chloride, carbacholine, carbocholine, jestryl, doryl, carbamylcholine chloride, miostat, isopto carbachol | |
| AIXAANGOTKPUOY-UHFFFAOYSA-N | |
| 2-carbamoyloxyethyl(trimethyl)azanium;chloride | |
| 5831 | |
| 182.65 | |
| Authentic | |
| Glass bottle |
Chemical Identifiers
| 51-83-2 | |
| 182.65 | |
| AIXAANGOTKPUOY-UHFFFAOYSA-N | |
| 5831 | |
| 2-carbamoyloxyethyl(trimethyl)azanium;chloride |
| C6H15ClN2O2 | |
| MFCD00012011 | |
| carbachol, carbamoylcholine chloride, carbachol chloride, carbacholine, carbocholine, jestryl, doryl, carbamylcholine chloride, miostat, isopto carbachol | |
| CHEBI:3385 | |
| [Cl-].C[N+](C)(C)CCOC(N)=O |
Safety and Handling
GHS H Statement
Fatal if swallowed.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wash face,hands and any exposed skin thoroughly after handling.
GHS Signal Word: Danger
EINECSNumber : 200-127-3
RUO – Research Use Only