missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromothymol Blue, Reagent, ACS, Spectrum™ Chemical
BR154, 76-59-5, 34722-90-2, C27H28O5SBr2
$265.27 - $5970.93
Chemical Identifiers
| CAS | 76-59-5 |
|---|---|
| Molecular Formula | C27H28Br2O5S |
| Molecular Weight (g/mol) | 624.38 |
| InChI Key | NUHCTOLBWMJMLX-UHFFFAOYSA-N |
| IUPAC Name | 3,3-bis[3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-3H-2,1λâ¶-benzoxathiole-1,1-dione |
| SMILES | CC(C)C1=CC(=C(C)C(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C(C)C)=C(O)C(Br)=C1C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
18601103
|
Spectrum Chemical Mfg Cor
BR1545GM |
5 g | Amber Glass Bottle |
Each for $265.27
|
|
||||
|
18601104
|
Spectrum Chemical Mfg Cor
BR15425GM |
25 g | Amber Glass Bottle |
Each for $697.87
|
|
||||
|
18601105
|
Spectrum Chemical Mfg Cor
BR154100GM |
100 g | Amber Glass Bottle |
Each for $2,543.90
|
|
||||
|
18601106
|
Spectrum Chemical Mfg Cor
BR1541KGBL |
1 kg | Amber Glass Bottle |
Each for $5,970.93
|
|
||||
Description
Spectrum™ Chemical Bromothymol Blue, Reagent, ACS is a pH indicator for weak acids and bases. It is mostly used in applications that require measuring substances that would have a relatively neutral pH (near 7), such as managing the pH of pools and fish tanks. As an ACS grade quality reagent, its chemical specifications are the de facto standards for chemicals used in many high-purity applications and typically designate the highest quality chemical available for laboratory use. Spectrum Chemical manufactured Reagent ACS grade products meet the toughest regulatory standards for quality and purity.Chemical Identifiers
| 76-59-5 | |
| 624.38 | |
| 3,3-bis[3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-3H-2,1λâ¶-benzoxathiole-1,1-dione |
| C27H28Br2O5S | |
| NUHCTOLBWMJMLX-UHFFFAOYSA-N | |
| CC(C)C1=CC(=C(C)C(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C(C)C)=C(O)C(Br)=C1C |
Specifications
| 76-59-5 | |
| C27H28Br2O5S | |
| CC(C)C1=CC(=C(C)C(Br)=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC(C(C)C)=C(O)C(Br)=C1C | |
| 624.38 | |
| Amber Glass Bottle | |
| 6.0 to 7.6 | |
| Bromothymol Blue |
| 100% | |
| NUHCTOLBWMJMLX-UHFFFAOYSA-N | |
| 3,3-bis[3-bromo-4-hydroxy-2-methyl-5-(propan-2-yl)phenyl]-3H-2,1λâ¶-benzoxathiole-1,1-dione | |
| ACS | |
| Purple/Violet | |
| 5 g |