missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(phenylsulfonyl)sulfide, 96%
CAS: 4388-22-1 | C12H10O4S3 | 314.39 g/mol
$682.67 - $682.67
Chemical Identifiers
| CAS | 4388-22-1 |
|---|---|
| Molecular Formula | C12H10O4S3 |
| Molecular Weight (g/mol) | 314.39 |
| MDL Number | MFCD00094733 |
| InChI Key | YQUSJUJNDKUWAM-UHFFFAOYSA-N |
| Synonym | bis phenylsulfonyl sulfide, benzenesulfonyl sulfide, benzenesulfonic thioanhydride, benzenesulfonothioic acid, anhydrosulfide, benzenesulfonic acid, thio-, anhydrosulfide, bis phenylsulfonyl thio, benzenesulfonyl sulfanylsulfonyl benzene, phso2 2s, benzenesulfonylthio sulfonylbenzene |
| PubChem CID | 257516 |
| IUPAC Name | benzenesulfonylsulfanylsulfonylbenzene |
| SMILES | O=S(=O)(SS(=O)(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC300830050
|
Thermo Scientific Chemicals
300830050 |
5 g | Glass bottle |
Each for $682.67
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 4388-22-1 | |
| 314.39 | |
| YQUSJUJNDKUWAM-UHFFFAOYSA-N | |
| 257516 | |
| O=S(=O)(SS(=O)(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| C12H10O4S3 | |
| MFCD00094733 | |
| bis phenylsulfonyl sulfide, benzenesulfonyl sulfide, benzenesulfonic thioanhydride, benzenesulfonothioic acid, anhydrosulfide, benzenesulfonic acid, thio-, anhydrosulfide, bis phenylsulfonyl thio, benzenesulfonyl sulfanylsulfonyl benzene, phso2 2s, benzenesulfonylthio sulfonylbenzene | |
| benzenesulfonylsulfanylsulfonylbenzene |
Specifications
| 4388-22-1 | |
| Pink to White | |
| 95% min. (HPLC) | |
| C12H10O4S3 | |
| 5 g | |
| bis phenylsulfonyl sulfide, benzenesulfonyl sulfide, benzenesulfonic thioanhydride, benzenesulfonothioic acid, anhydrosulfide, benzenesulfonic acid, thio-, anhydrosulfide, bis phenylsulfonyl thio, benzenesulfonyl sulfanylsulfonyl benzene, phso2 2s, benzenesulfonylthio sulfonylbenzene | |
| O=S(=O)(SS(=O)(=O)C1=CC=CC=C1)C1=CC=CC=C1 | |
| 314.39 | |
| 314.41 | |
| Crystals or Powder |
| 129.0°C to 134.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00094733 | |
| 11,III,163 | |
| YQUSJUJNDKUWAM-UHFFFAOYSA-N | |
| benzenesulfonylsulfanylsulfonylbenzene | |
| 257516 | |
| 96% | |
| Bis(phenylsulfonyl)sulfide |
RUO – Research Use Only