missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bifonazole, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 458620010
Specifications
| Bifonazole | |
| 149.0°C | |
| Authentic | |
| Glass Bottle | |
| 1 g | |
| OCAPBUJLXMYKEJ-UHFFFAOYSA-N | |
| 1-[phenyl-(4-phenylphenyl)methyl]imidazole | |
| 2378 | |
| 310.39 |
| 60628-96-8 | |
| 0.5% max. (1 g, 105°C, 1 h) | |
| 97.5% min. (HPLC) | |
| C22H18N2 | |
| bifonazole, mycospor, trifonazole, bifonazol, bifonazolum, amycor, azolmen, bifonazol inn-spanish, bifonazolum inn-latin, 1-4-biphenylyl phenylmethyl-1h-imidazole | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3)N4C=CN=C4 | |
| 310.39 | |
| CHEBI:78692 | |
| 98% |
Chemical Identifiers
| 60628-96-8 | |
| 310.39 | |
| bifonazole, mycospor, trifonazole, bifonazol, bifonazolum, amycor, azolmen, bifonazol inn-spanish, bifonazolum inn-latin, 1-4-biphenylyl phenylmethyl-1h-imidazole | |
| CHEBI:78692 | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3)N4C=CN=C4 |
| C22H18N2 | |
| OCAPBUJLXMYKEJ-UHFFFAOYSA-N | |
| 2378 | |
| 1-[phenyl-(4-phenylphenyl)methyl]imidazole |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 262-336-6
RUO – Research Use Only