missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Atomoxetine hydrochloride, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 467680010
Specifications
| Atomoxetine hydrochloride | |
| Available | |
| Powder | |
| 06410992 | |
| 166°C to 168°C | |
| LUCXVPAZUDVVBT-UNTBIKODSA-N | |
| hydrogen methyl[(3R)-3-(2-methylphenoxy)-3-phenylpropyl]amine chloride | |
| 1 g |
| Glass Bottle | |
| 82248-59-7 | |
| C17H22ClNO | |
| White to Beige | |
| Soluble in methanol | |
| [H+].[Cl-].CNCC[C@@H](OC1=CC=CC=C1C)C1=CC=CC=C1 | |
| 291.82 | |
| 291.82 |
Chemical Identifiers
| 82248-59-7 | |
| 291.82 | |
| LUCXVPAZUDVVBT-UNTBIKODSA-N | |
| [H+].[Cl-].CNCC[C@@H](OC1=CC=CC=C1C)C1=CC=CC=C1 |
| C17H22ClNO | |
| 06410992 | |
| hydrogen methyl[(3R)-3-(2-methylphenoxy)-3-phenylpropyl]amine chloride |
Safety and Handling
ShelfLife : 5 years
Recommended Storage : Refrigerator +4°C