missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Aspartame, Powder, FCC, 98-102%, Spectrum™ Chemical
A1377, 22839-47-0, C14H18N2O5
Supplier: Spectrum Chemical Mfg Cor A137725GM
Description
Spectrum™ Chemical Aspartame, Powder, FCC is a well known sugar substitute and artificial sweetener that is widely used in food and drinks. It much sweeter than sucrose and leaves a longer lasting taste. Spectrum Chemical offers over 300 Food Grade (FCC) chemical ingredients packaged in laboratory size bottles to production drum quantities and are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 22839-47-0 | |
| 0.2% | |
| 4.5% | |
| Poly Bottle | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| (3S)-3-amino-3-{[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl}propanoic acid | |
| 294.31 | |
| 98 to 102% |
| 100% | |
| 1 mg/kg | |
| C14H18N2O5 | |
| MFCD00002724 | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O | |
| 25 g | |
| +14.5° to +16.5° | |
| FCC |
Chemical Identifiers
| 22839-47-0 | |
| 294.31 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O |
| C14H18N2O5 | |
| MFCD00002724 | |
| (3S)-3-amino-3-{[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl}propanoic acid |