missing translation for 'onlineSavingsMsg'
Learn More
Learn More
9,10-Diphenylanthracene, 98%
CAS: 1499-10-1 | C26H18 | 330.43 g/mol
$103.98 - $374.22
Chemical Identifiers
| CAS | 1499-10-1 |
|---|---|
| Molecular Formula | C26H18 |
| Molecular Weight (g/mol) | 330.43 |
| MDL Number | MFCD00001253 |
| InChI Key | FCNCGHJSNVOIKE-UHFFFAOYSA-N |
| Synonym | anthracene, 9,10-diphenyl, 9,10-diphenyl anthracene, unii-51bq8iyq9u, 51bq8iyq9u, acmc-1brsc, 9, 9-diphenylanthracene, anthracene,10-diphenyl, 9,10-diphenylanthracene, 9,10-diphenylanthracene 1g, 9,10-diphenylanthracene, analytical standard |
| PubChem CID | 15159 |
| ChEBI | CHEBI:51676 |
| IUPAC Name | 9,10-diphenylanthracene |
| SMILES | C1=CC=C(C=C1)C1=C2C=CC=CC2=C(C2=CC=CC=C2)C2=CC=CC=C12 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117200010
|
Thermo Scientific Chemicals
117200010 |
1 g | Glass bottle |
Each for $103.98
|
|
||||
|
AC117200050
|
Thermo Scientific Chemicals
117200050 |
5 g | Glass bottle |
Each for $374.22
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1499-10-1 | |
| 330.43 | |
| FCNCGHJSNVOIKE-UHFFFAOYSA-N | |
| 15159 | |
| 9,10-diphenylanthracene |
| C26H18 | |
| MFCD00001253 | |
| anthracene, 9,10-diphenyl, 9,10-diphenyl anthracene, unii-51bq8iyq9u, 51bq8iyq9u, acmc-1brsc, 9, 9-diphenylanthracene, anthracene,10-diphenyl, 9,10-diphenylanthracene, 9,10-diphenylanthracene 1g, 9,10-diphenylanthracene, analytical standard | |
| CHEBI:51676 | |
| C1=CC=C(C=C1)C1=C2C=CC=CC2=C(C2=CC=CC=C2)C2=CC=CC=C12 |
Specifications
| 1499-10-1 | |
| 100.0 | |
| Yellow to Beige | |
| 97.5% min. (HPLC) | |
| C26H18 | |
| 1 g | |
| anthracene, 9,10-diphenyl, 9,10-diphenyl anthracene, unii-51bq8iyq9u, 51bq8iyq9u, acmc-1brsc, 9, 9-diphenylanthracene, anthracene,10-diphenyl, 9,10-diphenylanthracene, 9,10-diphenylanthracene 1g, 9,10-diphenylanthracene, analytical standard | |
| FCNCGHJSNVOIKE-UHFFFAOYSA-N | |
| 9,10-diphenylanthracene | |
| 15159 | |
| 330.42 | |
| Fine Crystalline Powder |
| 97.5 | |
| 248°C to 252°C | |
| Authentic | |
| Glass bottle | |
| MFCD00001253 | |
| 05,747 | |
| Solubility in water: insoluble. Other solubilities: soluble in ethanol,chloroform,benzene,carbon,disulfide,cyclohexane,acetonitrile,petroleum,ether | |
| C1=CC=C(C=C1)C1=C2C=CC=CC2=C(C2=CC=CC=C2)C2=CC=CC=C12 | |
| 330.43 | |
| CHEBI:51676 | |
| 98% | |
| 9, 10-Diphenylanthracene, 99% |
Safety and Handling
EINECSNumber : 216-105-1
TSCA : TSCA
RUO – Research Use Only