missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5,5'-Dithiobis(2-nitrobenzoic Acid) 98.0+%, TCI America™
Supplier: TCI America D09445G
Specifications
5,5′-Dithiobis(2-nitrobenzoic Acid) [for Determination of SH groups] | |
Yellow | |
MFCD00007140 | |
dtnb, 5,5'-dithiobis 2-nitrobenzoic acid, ellman's reagent, 3-carboxy-4-nitrophenyl disulfide, dithionitrobenzoic acid, dithiobisnitrobenzoic acid, 5,5'-disulfanediylbis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, 3,3'-dithiobis 6-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid | |
OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O | |
396.34 | |
CHEBI:86228 | |
≥98.0% (HPLC,T) |
69-78-3 | |
C14H8N2O8S2 | |
5 g | |
KIUMMUBSPKGMOY-UHFFFAOYSA-N | |
5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid | |
6254 | |
396.34 | |
Crystalline Powder |
Chemical Identifiers
69-78-3 | |
396.34 | |
KIUMMUBSPKGMOY-UHFFFAOYSA-N | |
6254 | |
5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
C14H8N2O8S2 | |
MFCD00007140 | |
dtnb, 5,5'-dithiobis 2-nitrobenzoic acid, ellman's reagent, 3-carboxy-4-nitrophenyl disulfide, dithionitrobenzoic acid, dithiobisnitrobenzoic acid, 5,5'-disulfanediylbis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, 3,3'-dithiobis 6-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid | |
CHEBI:86228 | |
OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
Safety and Handling
RTECSNumber : DG9650000
TSCA : Yes