missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Nitrophenyl acetate, 97%
CAS: 830-03-5 | C8H7NO4 | 181.15 g/mol
$79.88 - $387.00
Chemical Identifiers
| CAS | 830-03-5 |
|---|---|
| Molecular Formula | C8H7NO4 |
| Molecular Weight (g/mol) | 181.15 |
| MDL Number | MFCD00007326 |
| InChI Key | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| Synonym | p-nitrophenyl acetate, p-acetoxynitrobenzene, acetic acid, 4-nitrophenyl ester, p-nitrophenol acetate, acetic acid p-nitrophenyl ester, acetic acid, p-nitrophenyl ester, p-nitrophenyl acetate van, 4-nitrophenyl acetate, unii-i902j0qh9s, acetic acid 4-nitrophenyl ester |
| PubChem CID | 13243 |
| ChEBI | CHEBI:82635 |
| SMILES | CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128750050
|
Thermo Scientific Chemicals
128750050 |
5 g | Glass bottle |
Each for $79.88
|
|
||||
|
AC128750250
|
Thermo Scientific Chemicals
128750250 |
25 g | Plastic bottle |
Each for $146.39
|
|
||||
|
AC128751000
|
Thermo Scientific Chemicals
128751000 |
100 g | Plastic bottle |
Each for $387.00
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 830-03-5 | |
| 181.15 | |
| QAUUDNIGJSLPSX-UHFFFAOYSA-N | |
| 13243 | |
| CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O |
| C8H7NO4 | |
| MFCD00007326 | |
| p-nitrophenyl acetate, p-acetoxynitrobenzene, acetic acid, 4-nitrophenyl ester, p-nitrophenol acetate, acetic acid p-nitrophenyl ester, acetic acid, p-nitrophenyl ester, p-nitrophenyl acetate van, 4-nitrophenyl acetate, unii-i902j0qh9s, acetic acid 4-nitrophenyl ester | |
| CHEBI:82635 |
Specifications
| 830-03-5 | |
| 100.0 | |
| Green | |
| 96% min. (GC) | |
| C8H7NO4 | |
| MFCD00007326 | |
| 06, 233 | |
| p-nitrophenyl acetate, p-acetoxynitrobenzene, acetic acid, 4-nitrophenyl ester, p-nitrophenol acetate, acetic acid p-nitrophenyl ester, acetic acid, p-nitrophenyl ester, p-nitrophenyl acetate van, 4-nitrophenyl acetate, unii-i902j0qh9s, acetic acid 4-nitrophenyl ester | |
| QAUUDNIGJSLPSX-UHFFFAOYSA-N | |
| (4-nitrophenyl) acetate | |
| 13243 | |
| 181.15 | |
| Powder |
| 96.0 | |
| 76.0°C to 79.0°C | |
| Authentic | |
| Glass bottle | |
| CH3CO2C6H4NO2 | |
| 5 g | |
| 02,297 | |
| Solubility in water: insoluble | |
| CC(=O)OC1=CC=C(C=C1)[N+]([O-])=O | |
| 181.15 | |
| CHEBI:82635 | |
| 97% | |
| 4-Nitrophenyl acetate, 97% |
Safety and Handling
GHS Signal Word: Danger
EINECSNumber : 212-593-5
RTECSNumber : AJ1150000
TSCA : TSCA
RUO – Research Use Only