missing translation for 'onlineSavingsMsg'
Learn More
Learn More
![4-(4,6-Dimethoxy[1.3.5]triazin-2-yl)-4-methylmorpholinium chloride, 97%](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-3945-69-5.jpg-650.jpg)
![4-(4,6-Dimethoxy[1.3.5]triazin-2-yl)-4-methylmorpholinium chloride, 97%](https://assets.fishersci.com/TFS-Assets/CCG/logos/Thermo-Scientific-Stacked.jpg-650.jpg)
4-(4,6-Dimethoxy[1.3.5]triazin-2-yl)-4-methylmorpholinium chloride, 97%
CAS: 3945-69-5 | C10H17ClN4O3 | 276.72 g/mol
$515.50 - $515.50
Chemical Identifiers
| CAS | 3945-69-5 |
|---|---|
| Molecular Formula | C10H17ClN4O3 |
| Molecular Weight (g/mol) | 276.72 |
| MDL Number | MFCD03613550 |
| InChI Key | BMTZEAOGFDXDAD-UHFFFAOYSA-M |
| Synonym | dmtmm, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methylmorpholinium chloride, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methyl morpholinium chloride, dmt-mm, 4-4,6-dimethoxy-1,3,5-triazine-2-yl-4-methyl morpholinium chloride, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methylmorpholin-4-ium chloride, kunishima coupling reagent, mmtm, 4-4,6-dimethoxy-1,3,5 triazin-2-yl-4-methyl-morpholin-4-ium chloride |
| PubChem CID | 2734059 |
| SMILES | [Cl-].COC1=NC(=NC(OC)=N1)[N+]1(C)CCOCC1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC348960050
|
Thermo Scientific Chemicals
348960050 |
5 g | Glass bottle |
Each for $515.50
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Coupling reagentChemical Identifiers
| 3945-69-5 | |
| 276.72 | |
| BMTZEAOGFDXDAD-UHFFFAOYSA-M | |
| 2734059 |
| C10H17ClN4O3 | |
| MFCD03613550 | |
| dmtmm, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methylmorpholinium chloride, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methyl morpholinium chloride, dmt-mm, 4-4,6-dimethoxy-1,3,5-triazine-2-yl-4-methyl morpholinium chloride, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methylmorpholin-4-ium chloride, kunishima coupling reagent, mmtm, 4-4,6-dimethoxy-1,3,5 triazin-2-yl-4-methyl-morpholin-4-ium chloride | |
| [Cl-].COC1=NC(=NC(OC)=N1)[N+]1(C)CCOCC1 |
Specifications
| 3945-69-5 | |
| 100.0 | |
| White | |
| 97% | |
| C10H17ClN4O3 | |
| 5 g | |
| BMTZEAOGFDXDAD-UHFFFAOYSA-M | |
| 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium chloride | |
| 2734059 | |
| 97% | |
| 4-(4, 6-Dimethoxy[1.3.5]triazin-2-yl)-4-methylmorpholinium chloride |
| 99.0 | |
| 118°C to 120°C | |
| Authentic | |
| Glass bottle | |
| MFCD03613550 | |
| dmtmm, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methylmorpholinium chloride, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methyl morpholinium chloride, dmt-mm, 4-4,6-dimethoxy-1,3,5-triazine-2-yl-4-methyl morpholinium chloride, 4-4,6-dimethoxy-1,3,5-triazin-2-yl-4-methylmorpholin-4-ium chloride, kunishima coupling reagent, mmtm, 4-4,6-dimethoxy-1,3,5 triazin-2-yl-4-methyl-morpholin-4-ium chloride | |
| [Cl-].COC1=NC(=NC(OC)=N1)[N+]1(C)CCOCC1 | |
| 276.72 | |
| 276.72 | |
| Chunks and/or Powder |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
Immediately call a POISON CENTER or doctor/
GHS Signal Word: Danger
RUO – Research Use Only