missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,4,6-Tris(2-pyridyl)-s-triazine, For Spectrophotometric Det. of Fe, 99.0% (HPLC), MilliporeSigma™ Supelco™
2,4,6-Tris(2-pyridyl)-s-triazine is a Case and Koft compound generally used in determination of iron in a colorimetric analysis.
Supplier: Merck Emd Millipore 932855G
Description
Reagent for the spectrophotometric determination of Fe(II) and of total FeSpecifications
| 3682-35-7 | |
| C18H12N6 | |
| MFCD00006045 | |
| 2,4,6-Tri(2-pyridyl)-s-triazine; TPTZ | |
| C1=CC=C(N=C1)C1=NC(=NC(=N1)C1=CC=CC=N1)C1=CC=CC=N1 | |
| 312.34 | |
| ≥99.0% (HPLC) |
| 247°C to 249°C; 248°C to 251°C | |
| C18H12N6 | |
| 5 g | |
| KMVWNDHKTPHDMT-UHFFFAOYSA-N | |
| tris(pyridin-2-yl)-1,3,5-triazine | |
| 312.33 |
Chemical Identifiers
| 3682-35-7 | |
| 312.34 | |
| KMVWNDHKTPHDMT-UHFFFAOYSA-N | |
| tris(pyridin-2-yl)-1,3,5-triazine |
| C18H12N6 | |
| MFCD00006045 | |
| 2,4,6-Tri(2-pyridyl)-s-triazine; TPTZ | |
| C1=CC=C(N=C1)C1=NC(=NC(=N1)C1=CC=CC=N1)C1=CC=CC=N1 |
Safety and Handling
RTECSNumber : XZ2050000