missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-hexanesulfonic acid, sodium salt hydrate, 99%
CAS: 2832-45-3 | C6H13NaO3S | 188.22 g/mol
$122.19 - $1353.10
Chemical Identifiers
| CAS | 2832-45-3 |
|---|---|
| Molecular Formula | C6H13NaO3S |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00007542 |
| InChI Key | QWSZRRAAFHGKCH-UHFFFAOYSA-M |
| Synonym | sodium 1-hexanesulfonate, sodium hexane-1-sulfonate, sodium hexanesulfonate, 1-hexanesulfonic acid sodium salt, 1-hexanesulfonic acid, sodium salt, 1-hexanesulfonic acid, sodium salt 1:1, 1-hexane sulfonic acid sodium salt, hexyl sodium sulfonate, 1-hexanesulfonate, sodium, hexanesulfonic acid na-salt |
| PubChem CID | 23677630 |
| IUPAC Name | sodium;hexane-1-sulfonate |
| SMILES | [Na+].CCCCCCS([O-])(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC206120050
|
Thermo Scientific Chemicals
206120050 |
5 g | Glass bottle |
Each for $122.19
|
|
||||
|
AC206120250
|
Thermo Scientific Chemicals
206120250 |
25 g | Glass bottle |
Each for $372.97
|
|
||||
|
AC206121000
|
Thermo Scientific Chemicals
206121000 |
100 g | Glass bottle |
Each for $1,353.10
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2832-45-3 | |
| 188.22 | |
| QWSZRRAAFHGKCH-UHFFFAOYSA-M | |
| 23677630 | |
| [Na+].CCCCCCS([O-])(=O)=O |
| C6H13NaO3S | |
| MFCD00007542 | |
| sodium 1-hexanesulfonate, sodium hexane-1-sulfonate, sodium hexanesulfonate, 1-hexanesulfonic acid sodium salt, 1-hexanesulfonic acid, sodium salt, 1-hexanesulfonic acid, sodium salt 1:1, 1-hexane sulfonic acid sodium salt, hexyl sodium sulfonate, 1-hexanesulfonate, sodium, hexanesulfonic acid na-salt | |
| sodium;hexane-1-sulfonate |
Specifications
| 2832-45-3 | |
| >300.0°C | |
| Negligible | |
| Authentic | |
| Glass bottle | |
| CH3(CH2)5SO3Na·xH2O | |
| 5 g | |
| (10% in water) Clear colorless | |
| [Na+].CCCCCCS([O-])(=O)=O | |
| 188.22 | |
| 188.22 | |
| 99% | |
| 1-Hexanesulfonic acid, sodium salt hydrate |
| 5.5 w/v% aq. soln., pH 3, H3PO4, 0.06 max. at 280nm, 0.1 max. at 220nm, 1 max. at 210nm, 5.5 w/v% aq. soln., pH 3, H3PO4 at 0nm | |
| White | |
| 9.6% max. (100°C, 3 hrs) (vacuum) | |
| 99% | |
| C6H13NaO3S | |
| MFCD00007542 | |
| sodium 1-hexanesulfonate, sodium hexane-1-sulfonate, sodium hexanesulfonate, 1-hexanesulfonic acid sodium salt, 1-hexanesulfonic acid, sodium salt, 1-hexanesulfonic acid, sodium salt 1:1, 1-hexane sulfonic acid sodium salt, hexyl sodium sulfonate, 1-hexanesulfonate, sodium, hexanesulfonic acid na-salt | |
| QWSZRRAAFHGKCH-UHFFFAOYSA-M | |
| sodium;hexane-1-sulfonate | |
| 23677630 | |
| Negligible | |
| Crystalline Flakes or Solid |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Avoid breath
GHS Signal Word: Warning
RUO – Research Use Only