missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Heptanesulfonic Acid, Sodium Salt, 98%
CAS: 22767-50-6 | C7H15NaO3S | 202.25 g/mol
$76.29 - $2666.91
Chemical Identifiers
| CAS | 22767-50-6 |
|---|---|
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
| Synonym | sodium 1-heptanesulfonate, sodium heptane-1-sulfonate, 1-heptanesulfonic acid sodium salt, 1-heptanesulfonic acid, sodium salt, sodium heptane-1-sulphonate, 1-heptanesulfonic acid, sodium salt 1:1, 1-heptanesulfonic acid sodium, sodium heptanesulfonate, 1-heptylsodiumsulfonate, sodium heptane sulfonate |
| PubChem CID | 23672332 |
| IUPAC Name | sodium;heptane-1-sulfonate |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC206130050
|
Thermo Scientific Chemicals
206130050 |
5 g | Glass bottle |
Each for $76.29
|
|
||||
|
AC206130250
|
Thermo Scientific Chemicals
206130250 |
25 g | Glass Bottle |
Each for $303.94
|
|
||||
|
AC206131000
|
Thermo Scientific Chemicals
206131000 |
100 g | Glass Bottle |
Each for $884.52
|
|
||||
|
AC206135000
|
Thermo Scientific Chemicals
206135000 |
500 g | Glass Bottle |
Each for $2,666.91
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 22767-50-6 | |
| sodium 1-heptanesulfonate, sodium heptane-1-sulfonate, 1-heptanesulfonic acid sodium salt, 1-heptanesulfonic acid, sodium salt, sodium heptane-1-sulphonate, 1-heptanesulfonic acid, sodium salt 1:1, 1-heptanesulfonic acid sodium, sodium heptanesulfonate, 1-heptylsodiumsulfonate, sodium heptane sulfonate | |
| sodium;heptane-1-sulfonate |
| REFMEZARFCPESH-UHFFFAOYSA-M | |
| 23672332 | |
| CCCCCCCS(=O)(=O)[O-].[Na+] |
Specifications
| 22767-50-6 | |
| White | |
| Authentic | |
| Glass bottle | |
| CH3(CH2)6SO3Na | |
| 04, IV, 57 | |
| (10% in water) Clear colorless | |
| CCCCCCCS(=O)(=O)[O-].[Na+] | |
| 202.25 | |
| 202.25 | |
| Crystalline Powder or Flakes |
| >300.0°C | |
| 9% max. (100°C, 3 hrs) (vacuum) | |
| 98% | |
| C7H15NaO3S | |
| 5 g | |
| sodium 1-heptanesulfonate, sodium heptane-1-sulfonate, 1-heptanesulfonic acid sodium salt, 1-heptanesulfonic acid, sodium salt, sodium heptane-1-sulphonate, 1-heptanesulfonic acid, sodium salt 1:1, 1-heptanesulfonic acid sodium, sodium heptanesulfonate, 1-heptylsodiumsulfonate, sodium heptane sulfonate | |
| REFMEZARFCPESH-UHFFFAOYSA-M | |
| sodium;heptane-1-sulfonate | |
| 23672332 | |
| 98% | |
| 1-Heptanesulfonic acid, sodium salt |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 245-210-5
RUO – Research Use Only