missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Fluoro-2-nitrobenzene, 99%
CAS: 1493-27-2 | C6H4FNO2 | 141.1 g/mol
$180.19 - $180.19
Chemical Identifiers
| CAS | 1493-27-2 |
|---|---|
| Molecular Formula | C6H4FNO2 |
| Molecular Weight (g/mol) | 141.1 |
| MDL Number | MFCD00007048 |
| InChI Key | PWKNBLFSJAVFAB-UHFFFAOYSA-N |
| Synonym | 2-fluoronitrobenzene, o-fluoronitrobenzene, o-nitrofluorobenzene, 2-nitrofluorobenzene, benzene, 1-fluoro-2-nitro, benzene, o-nitrofluoro, 2-fluoro-1-nitrobenzene, fluoronitrobenzene, 1-fluoro-2-nitro-benzene, benzene, fluoronitro |
| PubChem CID | 73895 |
| IUPAC Name | 1-fluoro-2-nitrobenzene |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC119480500
|
Thermo Scientific Chemicals
119480500 |
50 mL | Glass bottle |
Each for $180.19
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1493-27-2 | |
| 141.1 | |
| PWKNBLFSJAVFAB-UHFFFAOYSA-N | |
| 73895 | |
| C1=CC=C(C(=C1)[N+](=O)[O-])F |
| C6H4FNO2 | |
| MFCD00007048 | |
| 2-fluoronitrobenzene, o-fluoronitrobenzene, o-nitrofluorobenzene, 2-nitrofluorobenzene, benzene, 1-fluoro-2-nitro, benzene, o-nitrofluoro, 2-fluoro-1-nitrobenzene, fluoronitrobenzene, 1-fluoro-2-nitro-benzene, benzene, fluoronitro | |
| 1-fluoro-2-nitrobenzene |
Specifications
| 1493-27-2 | |
| 100.0 | |
| Brown to Yellow | |
| 215°C | |
| Authentic | |
| Glass bottle | |
| 1.5307 to 1.5327 | |
| MFCD00007048 | |
| 05, 241 | |
| 2-fluoronitrobenzene, o-fluoronitrobenzene, o-nitrofluorobenzene, 2-nitrofluorobenzene, benzene, 1-fluoro-2-nitro, benzene, o-nitrofluoro, 2-fluoro-1-nitrobenzene, fluoronitrobenzene, 1-fluoro-2-nitro-benzene, benzene, fluoronitro | |
| PWKNBLFSJAVFAB-UHFFFAOYSA-N | |
| 1-fluoro-2-nitrobenzene | |
| 73895 | |
| 99% | |
| 1-Fluoro-2-nitrobenzene |
| 98.5 | |
| -9°C to 6°C | |
| 1.3350g/mL | |
| 94°C | |
| 98.5% min. (GC) | |
| C6H4FNO2 | |
| FC6H4NO2 | |
| 50 mL | |
| 1.335 | |
| Solubility in water: immiscible | |
| C1=CC=C(C(=C1)[N+](=O)[O-])F | |
| 141.1 | |
| 141.1 | |
| Liquid |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Fatal in contact with skin.
Causes serious eye irritation.
May cause damage to organs through prolonged or repeated exposure.
Causes skin irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Immediately call a POISON CENTER or doctor/physician.
If skin irritation occurs: Get medical
GHS Signal Word: Danger
EINECSNumber : 216-088-
RUO – Research Use Only